C5H8N2S — CID 82418738
1-(1,2-thiazol-5-yl)ethanamine (PubChem CID 82418738) has the molecular formula C5H8N2S and a molecular weight of 128.20 g/mol. Its IUPAC name is 1-(1,2-thiazol-5-yl)ethanamine.
| Compound Name | 1-(1,2-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 82418738 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 1-(1,2-thiazol-5-yl)ethanamine |
| SMILES | CC(N)c1ccns1 |
| InChI | InChI=1S/C5H8N2S/c1-4(6)5-2-3-7-8-5/h2-4H,6H2,1H3 |
| InChIKey | YASLCOVGVSMIMR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |