C7H9FN2S — CID 130900761
3-fluoro-3-(1,2-thiazol-5-yl)cyclobutan-1-amine (PubChem CID 130900761) has the molecular formula C7H9FN2S and a molecular weight of 172.23 g/mol. Its IUPAC name is 3-fluoro-3-(1,2-thiazol-5-yl)cyclobutan-1-amine.
| Compound Name | 3-fluoro-3-(1,2-thiazol-5-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 130900761 |
| Molecular Formula | C7H9FN2S |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 3-fluoro-3-(1,2-thiazol-5-yl)cyclobutan-1-amine |
| SMILES | NC1CC(F)(c2ccns2)C1 |
| InChI | InChI=1S/C7H9FN2S/c8-7(3-5(9)4-7)6-1-2-10-11-6/h1-2,5H,3-4,9H2 |
| InChIKey | FLCHFFOTMSUDAI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |