C6H9NS — CID 23570577
5-propan-2-yl-1,2-thiazole (PubChem CID 23570577) has the molecular formula C6H9NS and a molecular weight of 127.21 g/mol. Its IUPAC name is 5-propan-2-yl-1,2-thiazole.
| Compound Name | 5-propan-2-yl-1,2-thiazole |
|---|---|
| PubChem CID | 23570577 |
| Molecular Formula | C6H9NS |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | 5-propan-2-yl-1,2-thiazole |
| SMILES | CC(C)c1ccns1 |
| InChI | InChI=1S/C6H9NS/c1-5(2)6-3-4-7-8-6/h3-5H,1-2H3 |
| InChIKey | WQHKPJGEPSIORA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |