C7H10N2O2S — CID 21271229
ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate (PubChem CID 21271229) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate.
| Compound Name | ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate |
|---|---|
| PubChem CID | 21271229 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate |
| SMILES | [H]/N=C(\OCC)C(O)c1ccns1 |
| InChI | InChI=1S/C7H10N2O2S/c1-2-11-7(8)6(10)5-3-4-9-12-5/h3-4,6,8,10H,2H2,1H3/b8-7- |
| InChIKey | WZEYHPSSGXZOMU-FPLPWBNLSA-N |
| XLogP | 1.19 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|