C10H16O3 — CID 130876180
(3S,5S)-3-(4-hydroxy-3-methylbut-2-enyl)-5-methyloxolan-2-one (PubChem CID 130876180) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (3S,5S)-3-(4-hydroxy-3-methylbut-2-enyl)-5-methyloxolan-2-one.
| Compound Name | (3S,5S)-3-(4-hydroxy-3-methylbut-2-enyl)-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 130876180 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (3S,5S)-3-(4-hydroxy-3-methylbut-2-enyl)-5-methyloxolan-2-one |
| SMILES | CC(=CC[C@H]1C[C@H](C)OC1=O)CO |
| InChI | InChI=1S/C10H16O3/c1-7(6-11)3-4-9-5-8(2)13-10(9)12/h3,8-9,11H,4-6H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | ADBMMOURWGZZKA-IUCAKERBSA-N |
| XLogP | 1.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|