C10H6FNO2S — CID 130878805
2-fluoro-5-(1,3-thiazol-4-yl)benzoic acid (PubChem CID 130878805) has the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-fluoro-5-(1,3-thiazol-4-yl)benzoic acid.
| Compound Name | 2-fluoro-5-(1,3-thiazol-4-yl)benzoic acid |
|---|---|
| PubChem CID | 130878805 |
| Molecular Formula | C10H6FNO2S |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 2-fluoro-5-(1,3-thiazol-4-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2cscn2)ccc1F |
| InChI | InChI=1S/C10H6FNO2S/c11-8-2-1-6(3-7(8)10(13)14)9-4-15-5-12-9/h1-5H,(H,13,14) |
| InChIKey | RMHHHVZGMXAEHO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |