C11H18OSi — CID 130883505
cis-(1S,2R)-2-but-1-ynyl-2-trimethylsilylcyclopropane-1-carbaldehyde (PubChem CID 130883505) has the molecular formula C11H18OSi and a molecular weight of 194.35 g/mol. Its IUPAC name is cis-(1S,2R)-2-but-1-ynyl-2-trimethylsilylcyclopropane-1-carbaldehyde.
| Compound Name | cis-(1S,2R)-2-but-1-ynyl-2-trimethylsilylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 130883505 |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.35 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | cis-(1S,2R)-2-but-1-ynyl-2-trimethylsilylcyclopropane-1-carbaldehyde |
| SMILES | CCC#C[C@@]1([Si](C)(C)C)C[C@H]1C=O |
| InChI | InChI=1S/C11H18OSi/c1-5-6-7-11(13(2,3)4)8-10(11)9-12/h9-10H,5,8H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | ZKOMBGQACIWBPD-WDEREUQCSA-N |
| XLogP | 2.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|