C11H20O2Si — CID 14115191
cis-(1R,2R)-2-[tert-butyl(dimethyl)silyl]carbonylcyclopropane-1-carbaldehyde (PubChem CID 14115191) has the molecular formula C11H20O2Si and a molecular weight of 212.36 g/mol. Its IUPAC name is cis-(1R,2R)-2-[tert-butyl(dimethyl)silyl]carbonylcyclopropane-1-carbaldehyde.
| Compound Name | cis-(1R,2R)-2-[tert-butyl(dimethyl)silyl]carbonylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 14115191 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | cis-(1R,2R)-2-[tert-butyl(dimethyl)silyl]carbonylcyclopropane-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)C(=O)[C@@H]1C[C@H]1C=O |
| InChI | InChI=1S/C11H20O2Si/c1-11(2,3)14(4,5)10(13)9-6-8(9)7-12/h7-9H,6H2,1-5H3/t8-,9+/m0/s1 |
| InChIKey | WGEFSSOZYJRULP-DTWKUNHWSA-N |
| XLogP | 2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|