C13H22OSi — CID 134995405
cis-(1S,2R)-2-hex-1-ynyl-2-trimethylsilylcyclopropane-1-carbaldehyde (PubChem CID 134995405) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is cis-(1S,2R)-2-hex-1-ynyl-2-trimethylsilylcyclopropane-1-carbaldehyde.
| Compound Name | cis-(1S,2R)-2-hex-1-ynyl-2-trimethylsilylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 134995405 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | cis-(1S,2R)-2-hex-1-ynyl-2-trimethylsilylcyclopropane-1-carbaldehyde |
| SMILES | CCCCC#C[C@@]1([Si](C)(C)C)C[C@H]1C=O |
| InChI | InChI=1S/C13H22OSi/c1-5-6-7-8-9-13(15(2,3)4)10-12(13)11-14/h11-12H,5-7,10H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | SMRSTDJTBQGGCB-QWHCGFSZSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|