C9H18OSi — CID 12753689
2,3-dimethyl-1-trimethylsilylcyclopropane-1-carbaldehyde (PubChem CID 12753689) has the molecular formula C9H18OSi and a molecular weight of 170.33 g/mol. Its IUPAC name is 2,3-dimethyl-1-trimethylsilylcyclopropane-1-carbaldehyde.
| Compound Name | 2,3-dimethyl-1-trimethylsilylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 12753689 |
| Molecular Formula | C9H18OSi |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2,3-dimethyl-1-trimethylsilylcyclopropane-1-carbaldehyde |
| SMILES | CC1C(C)C1(C=O)[Si](C)(C)C |
| InChI | InChI=1S/C9H18OSi/c1-7-8(2)9(7,6-10)11(3,4)5/h6-8H,1-5H3 |
| InChIKey | WPABWSPZVCGXQB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|