C8H16OSi — CID 131027443
cis-(1S,2R)-2-(trimethylsilylmethyl)cyclopropane-1-carbaldehyde (PubChem CID 131027443) has the molecular formula C8H16OSi and a molecular weight of 156.30 g/mol. Its IUPAC name is cis-(1S,2R)-2-(trimethylsilylmethyl)cyclopropane-1-carbaldehyde.
| Compound Name | cis-(1S,2R)-2-(trimethylsilylmethyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 131027443 |
| Molecular Formula | C8H16OSi |
| Molecular Weight | 156.30 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | cis-(1S,2R)-2-(trimethylsilylmethyl)cyclopropane-1-carbaldehyde |
| SMILES | C[Si](C)(C)C[C@@H]1C[C@@H]1C=O |
| InChI | InChI=1S/C8H16OSi/c1-10(2,3)6-8-4-7(8)5-9/h5,7-8H,4,6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | UDZXGIWMVOMKTF-SFYZADRCSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|