About 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid
3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid (PubChem CID 130884712) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid |
| PubChem CID | 130884712 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid |
| SMILES | O=C(O)CCN1[C@H]2CCNC[C@@H]1CC2 |
| InChI | InChI=1S/C10H18N2O2/c13-10(14)4-6-12-8-1-2-9(12)7-11-5-3-8/h8-9,11H,1-7H2,(H,13,14)/t8-,9+/m1/s1 |
| InChIKey | JBYZXXUBQFHZPV-BDAKNGLRSA-N |
| XLogP | 0.29 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid?
The IUPAC name of 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid (CID 130884712) is 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid.
What is the SMILES notation for 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid?
The canonical SMILES for 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid is O=C(O)CCN1[C@H]2CCNC[C@@H]1CC2.
What is the InChIKey of 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid?
The InChIKey is JBYZXXUBQFHZPV-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H18N2O2/c13-10(14)4-6-12-8-1-2-9(12)7-11-5-3-8/h8-9,11H,1-7H2,(H,13,14)/t8-,9+/m1/s1.
What are the key properties of 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid?
3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid has a molecular weight of 198.27 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]propanoic acid is sourced from PubChem (CID 130884712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).