About 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide
2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide (PubChem CID 130763606) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide |
| PubChem CID | 130763606 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1[C@H]2CCNC[C@@H]1CC2 |
| InChI | InChI=1S/C10H19N3O/c1-11-10(14)7-13-8-2-3-9(13)6-12-5-4-8/h8-9,12H,2-7H2,1H3,(H,11,14)/t8-,9+/m1/s1 |
| InChIKey | HQGWECWYINLJBB-BDAKNGLRSA-N |
| XLogP | -0.44 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide?
The IUPAC name of 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide (CID 130763606) is 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide.
What is the SMILES notation for 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide?
The canonical SMILES for 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide is CNC(=O)CN1[C@H]2CCNC[C@@H]1CC2.
What is the InChIKey of 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide?
The InChIKey is HQGWECWYINLJBB-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H19N3O/c1-11-10(14)7-13-8-2-3-9(13)6-12-5-4-8/h8-9,12H,2-7H2,1H3,(H,11,14)/t8-,9+/m1/s1.
What are the key properties of 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide?
2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide has a molecular weight of 197.28 g/mol, XLogP of -0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-9-yl]-N-methylacetamide is sourced from PubChem (CID 130763606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).