C9H15NO2 — CID 130891281
(5S,8R)-5-(1-hydroxyethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 130891281) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (5S,8R)-5-(1-hydroxyethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (5S,8R)-5-(1-hydroxyethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 130891281 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (5S,8R)-5-(1-hydroxyethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CC(O)[C@@H]1CC[C@@H]2CCC(=O)N21 |
| InChI | InChI=1S/C9H15NO2/c1-6(11)8-4-2-7-3-5-9(12)10(7)8/h6-8,11H,2-5H2,1H3/t6?,7-,8+/m1/s1 |
| InChIKey | KUVOQHORKMJZHS-VVXQKDJTSA-N |
| XLogP | 0.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |