C8H16N4O2 — CID 130892425
3,3-dimethyl-1-(2-methyltetrazol-5-yl)butane-1,2-diol (PubChem CID 130892425) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methyltetrazol-5-yl)butane-1,2-diol.
| Compound Name | 3,3-dimethyl-1-(2-methyltetrazol-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 130892425 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3,3-dimethyl-1-(2-methyltetrazol-5-yl)butane-1,2-diol |
| SMILES | Cn1nnc(C(O)C(O)C(C)(C)C)n1 |
| InChI | InChI=1S/C8H16N4O2/c1-8(2,3)6(14)5(13)7-9-11-12(4)10-7/h5-6,13-14H,1-4H3 |
| InChIKey | GSYOSKRHCMMGMM-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |