C19H28N2O — CID 130892782
4-(4-benzyl-2-methyl-1,4-diazepan-1-yl)cyclohexan-1-one (PubChem CID 130892782) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-(4-benzyl-2-methyl-1,4-diazepan-1-yl)cyclohexan-1-one.
| Compound Name | 4-(4-benzyl-2-methyl-1,4-diazepan-1-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 130892782 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 4-(4-benzyl-2-methyl-1,4-diazepan-1-yl)cyclohexan-1-one |
| SMILES | CC1CN(Cc2ccccc2)CCCN1C1CCC(=O)CC1 |
| InChI | InChI=1S/C19H28N2O/c1-16-14-20(15-17-6-3-2-4-7-17)12-5-13-21(16)18-8-10-19(22)11-9-18/h2-4,6-7,16,18H,5,8-15H2,1H3 |
| InChIKey | VFSVEOZVJREHPS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |