C11H17NO — CID 130898732
(4R,4aR)-4,4a-dimethyl-1,3,4,5,6,7-hexahydroquinolin-2-one (PubChem CID 130898732) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (4R,4aR)-4,4a-dimethyl-1,3,4,5,6,7-hexahydroquinolin-2-one.
| Compound Name | (4R,4aR)-4,4a-dimethyl-1,3,4,5,6,7-hexahydroquinolin-2-one |
|---|---|
| PubChem CID | 130898732 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (4R,4aR)-4,4a-dimethyl-1,3,4,5,6,7-hexahydroquinolin-2-one |
| SMILES | C[C@@H]1CC(=O)NC2=CCCC[C@@]21C |
| InChI | InChI=1S/C11H17NO/c1-8-7-10(13)12-9-5-3-4-6-11(8,9)2/h5,8H,3-4,6-7H2,1-2H3,(H,12,13)/t8-,11-/m1/s1 |
| InChIKey | WFMAOXQJWJAHJL-LDYMZIIASA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |