C6H16N2S2 — CID 130899234
2-N-[2-(methyldisulfanyl)ethyl]propane-1,2-diamine (PubChem CID 130899234) has the molecular formula C6H16N2S2 and a molecular weight of 180.34 g/mol. Its IUPAC name is 2-N-[2-(methyldisulfanyl)ethyl]propane-1,2-diamine.
| Compound Name | 2-N-[2-(methyldisulfanyl)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 130899234 |
| Molecular Formula | C6H16N2S2 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-N-[2-(methyldisulfanyl)ethyl]propane-1,2-diamine |
| SMILES | CSSCCNC(C)CN |
| InChI | InChI=1S/C6H16N2S2/c1-6(5-7)8-3-4-10-9-2/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | LVJMUPZYKMFWRD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|