C10H14N2OS — CID 130899247
(6-methylpiperidin-3-yl)-(1,2-thiazol-3-yl)methanone (PubChem CID 130899247) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is (6-methylpiperidin-3-yl)-(1,2-thiazol-3-yl)methanone.
| Compound Name | (6-methylpiperidin-3-yl)-(1,2-thiazol-3-yl)methanone |
|---|---|
| PubChem CID | 130899247 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (6-methylpiperidin-3-yl)-(1,2-thiazol-3-yl)methanone |
| SMILES | CC1CCC(C(=O)c2ccsn2)CN1 |
| InChI | InChI=1S/C10H14N2OS/c1-7-2-3-8(6-11-7)10(13)9-4-5-14-12-9/h4-5,7-8,11H,2-3,6H2,1H3 |
| InChIKey | ICSLLAJRUOPFTD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |