C8H9NOS — CID 130693406
cyclobutyl(1,2-thiazol-3-yl)methanone (PubChem CID 130693406) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is cyclobutyl(1,2-thiazol-3-yl)methanone.
| Compound Name | cyclobutyl(1,2-thiazol-3-yl)methanone |
|---|---|
| PubChem CID | 130693406 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | cyclobutyl(1,2-thiazol-3-yl)methanone |
| SMILES | O=C(c1ccsn1)C1CCC1 |
| InChI | InChI=1S/C8H9NOS/c10-8(6-2-1-3-6)7-4-5-11-9-7/h4-6H,1-3H2 |
| InChIKey | HVUIMTLLFZRNSD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |