C7H11BrF2N2O — CID 130901596
N-(2-bromo-2,2-difluoroethyl)-3-methylazetidine-3-carboxamide (PubChem CID 130901596) has the molecular formula C7H11BrF2N2O and a molecular weight of 257.08 g/mol. Its IUPAC name is N-(2-bromo-2,2-difluoroethyl)-3-methylazetidine-3-carboxamide.
| Compound Name | N-(2-bromo-2,2-difluoroethyl)-3-methylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 130901596 |
| Molecular Formula | C7H11BrF2N2O |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | N-(2-bromo-2,2-difluoroethyl)-3-methylazetidine-3-carboxamide |
| SMILES | CC1(C(=O)NCC(F)(F)Br)CNC1 |
| InChI | InChI=1S/C7H11BrF2N2O/c1-6(2-11-3-6)5(13)12-4-7(8,9)10/h11H,2-4H2,1H3,(H,12,13) |
| InChIKey | VRZXDHQJAJXCMT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|