C10H21ClN2O — CID 174983357
3-methyl-N-(3-methylbutyl)azetidine-3-carboxamide;hydrochloride (PubChem CID 174983357) has the molecular formula C10H21ClN2O and a molecular weight of 220.74 g/mol. Its IUPAC name is 3-methyl-N-(3-methylbutyl)azetidine-3-carboxamide;hydrochloride.
| Compound Name | 3-methyl-N-(3-methylbutyl)azetidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 174983357 |
| Molecular Formula | C10H21ClN2O |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-methyl-N-(3-methylbutyl)azetidine-3-carboxamide;hydrochloride |
| SMILES | CC(C)CCNC(=O)C1(C)CNC1.Cl |
| InChI | InChI=1S/C10H20N2O.ClH/c1-8(2)4-5-12-9(13)10(3)6-11-7-10;/h8,11H,4-7H2,1-3H3,(H,12,13);1H |
| InChIKey | WLGVYJXBDAMBMG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |