C8H8Cl2N2O — CID 130905184
2,2-dichloro-N-pyrrol-1-ylcyclopropane-1-carboxamide (PubChem CID 130905184) has the molecular formula C8H8Cl2N2O and a molecular weight of 219.07 g/mol. Its IUPAC name is 2,2-dichloro-N-pyrrol-1-ylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-pyrrol-1-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 130905184 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2,2-dichloro-N-pyrrol-1-ylcyclopropane-1-carboxamide |
| SMILES | O=C(Nn1cccc1)C1CC1(Cl)Cl |
| InChI | InChI=1S/C8H8Cl2N2O/c9-8(10)5-6(8)7(13)11-12-3-1-2-4-12/h1-4,6H,5H2,(H,11,13) |
| InChIKey | TXRKRUAAEBLMPZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|