C11H12N2S — CID 130905421
2-ethyl-4-(1,3-thiazol-4-yl)aniline (PubChem CID 130905421) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 2-ethyl-4-(1,3-thiazol-4-yl)aniline.
| Compound Name | 2-ethyl-4-(1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 130905421 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-ethyl-4-(1,3-thiazol-4-yl)aniline |
| SMILES | CCc1cc(-c2cscn2)ccc1N |
| InChI | InChI=1S/C11H12N2S/c1-2-8-5-9(3-4-10(8)12)11-6-14-7-13-11/h3-7H,2,12H2,1H3 |
| InChIKey | BFDHJZQHNSASMX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|