C10H17N3O — CID 130905531
3-(4-methyl-1,2,4-triazol-3-yl)cycloheptan-1-ol (PubChem CID 130905531) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-(4-methyl-1,2,4-triazol-3-yl)cycloheptan-1-ol.
| Compound Name | 3-(4-methyl-1,2,4-triazol-3-yl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 130905531 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-(4-methyl-1,2,4-triazol-3-yl)cycloheptan-1-ol |
| SMILES | Cn1cnnc1C1CCCCC(O)C1 |
| InChI | InChI=1S/C10H17N3O/c1-13-7-11-12-10(13)8-4-2-3-5-9(14)6-8/h7-9,14H,2-6H2,1H3 |
| InChIKey | BFIGTJRDAGAQLG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |