C9H16OS — CID 130905886
[(1S)-4-ethylsulfanylcyclohex-3-en-1-yl]methanol (PubChem CID 130905886) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is [(1S)-4-ethylsulfanylcyclohex-3-en-1-yl]methanol.
| Compound Name | [(1S)-4-ethylsulfanylcyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 130905886 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | [(1S)-4-ethylsulfanylcyclohex-3-en-1-yl]methanol |
| SMILES | CCSC1=CC[C@@H](CO)CC1 |
| InChI | InChI=1S/C9H16OS/c1-2-11-9-5-3-8(7-10)4-6-9/h5,8,10H,2-4,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | MZAXVOZJSVMIEC-MRVPVSSYSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |