C9H15N3 — CID 130906329
N-(cyclobutylmethyl)-N-methyl-1H-imidazol-2-amine (PubChem CID 130906329) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N-methyl-1H-imidazol-2-amine.
| Compound Name | N-(cyclobutylmethyl)-N-methyl-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 130906329 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-(cyclobutylmethyl)-N-methyl-1H-imidazol-2-amine |
| SMILES | CN(CC1CCC1)c1ncc[nH]1 |
| InChI | InChI=1S/C9H15N3/c1-12(7-8-3-2-4-8)9-10-5-6-11-9/h5-6,8H,2-4,7H2,1H3,(H,10,11) |
| InChIKey | GOMFTQRDPBRTMF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |