C6H12N4O2 — CID 130908924
3-(1,3-diaminopropan-2-yl)imidazolidine-2,4-dione (PubChem CID 130908924) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is 3-(1,3-diaminopropan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 3-(1,3-diaminopropan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130908924 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3-(1,3-diaminopropan-2-yl)imidazolidine-2,4-dione |
| SMILES | NCC(CN)N1C(=O)CNC1=O |
| InChI | InChI=1S/C6H12N4O2/c7-1-4(2-8)10-5(11)3-9-6(10)12/h4H,1-3,7-8H2,(H,9,12) |
| InChIKey | KNSVTYZQODSYOH-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|