C21H17ClN4O3S2 — CID 1309128
N-(1,3-benzodioxol-5-ylmethyl)-3-[[5-(4-chlorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl]propanamide (PubChem CID 1309128) has the molecular formula C21H17ClN4O3S2 and a molecular weight of 472.98 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[[5-(4-chlorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[[5-(4-chlorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 1309128 |
| Molecular Formula | C21H17ClN4O3S2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[[5-(4-chlorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl]propanamide |
| SMILES | O=C(CCSc1nnc2scc(-c3ccc(Cl)cc3)n12)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H17ClN4O3S2/c22-15-4-2-14(3-5-15)16-11-31-21-25-24-20(26(16)21)30-8-7-19(27)23-10-13-1-6-17-18(9-13)29-12-28-17/h1-6,9,11H,7-8,10,12H2,(H,23,27) |
| InChIKey | GDRBLFSOSFJPHK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |