C18H11F2N3O2S2 — CID 71539671
3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(3,4-difluorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 71539671) has the molecular formula C18H11F2N3O2S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(3,4-difluorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(3,4-difluorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 71539671 |
| Molecular Formula | C18H11F2N3O2S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylsulfanyl)-5-(3,4-difluorophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | Fc1ccc(-c2csc3nnc(SCc4ccc5c(c4)OCO5)n23)cc1F |
| InChI | InChI=1S/C18H11F2N3O2S2/c19-12-3-2-11(6-13(12)20)14-8-27-18-22-21-17(23(14)18)26-7-10-1-4-15-16(5-10)25-9-24-15/h1-6,8H,7,9H2 |
| InChIKey | QNGBIPKMYHDCCT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |