About [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone
[1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone (PubChem CID 130918603) has the molecular formula C9H12N2OS
and a molecular weight of 196.28 g/mol. Its IUPAC name is [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone.
Molecular Properties
| Compound Name | [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone |
| PubChem CID | 130918603 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone |
| SMILES | CNC1(C(=O)c2ccsn2)CCC1 |
| InChI | InChI=1S/C9H12N2OS/c1-10-9(4-2-5-9)8(12)7-3-6-13-11-7/h3,6,10H,2,4-5H2,1H3 |
| InChIKey | KFFXTAKAWAIQDG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone?
The IUPAC name of [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone (CID 130918603) is [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone.
What is the SMILES notation for [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone?
The canonical SMILES for [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone is CNC1(C(=O)c2ccsn2)CCC1.
What is the InChIKey of [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone?
The InChIKey is KFFXTAKAWAIQDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-10-9(4-2-5-9)8(12)7-3-6-13-11-7/h3,6,10H,2,4-5H2,1H3.
What are the key properties of [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone?
[1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone has a molecular weight of 196.28 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(methylamino)cyclobutyl]-(1,2-thiazol-3-yl)methanone is sourced from PubChem (CID 130918603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).