C8H10N2OS — CID 170766527
pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone (PubChem CID 170766527) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone.
| Compound Name | pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone |
|---|---|
| PubChem CID | 170766527 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone |
| SMILES | O=C(c1ccsn1)N1CCCC1 |
| InChI | InChI=1S/C8H10N2OS/c11-8(7-3-6-12-9-7)10-4-1-2-5-10/h3,6H,1-2,4-5H2 |
| InChIKey | QCCQJMJUXHSLOM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |