About pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone
pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone (PubChem CID 170766527) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone.
Molecular Properties
| Compound Name | pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone |
| PubChem CID | 170766527 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone |
| SMILES | O=C(c1ccsn1)N1CCCC1 |
| InChI | InChI=1S/C8H10N2OS/c11-8(7-3-6-12-9-7)10-4-1-2-5-10/h3,6H,1-2,4-5H2 |
| InChIKey | QCCQJMJUXHSLOM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone?
The IUPAC name of pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone (CID 170766527) is pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone.
What is the SMILES notation for pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone?
The canonical SMILES for pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone is O=C(c1ccsn1)N1CCCC1.
What is the InChIKey of pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone?
The InChIKey is QCCQJMJUXHSLOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c11-8(7-3-6-12-9-7)10-4-1-2-5-10/h3,6H,1-2,4-5H2.
What are the key properties of pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone?
pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone has a molecular weight of 182.25 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl(1,2-thiazol-3-yl)methanone is sourced from PubChem (CID 170766527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).