About N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine
N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine (PubChem CID 130920507) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine.
Analyze N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine?
The IUPAC name of N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine (CID 130920507) is N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine.
What is the SMILES notation for N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine?
The canonical SMILES for N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine is CC1CCC(N(C)CC2CC2)C1.
What is the InChIKey of N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine?
The InChIKey is NCANLAUVVHUBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-9-3-6-11(7-9)12(2)8-10-4-5-10/h9-11H,3-8H2,1-2H3.
What are the key properties of N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine?
N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine has a molecular weight of 167.30 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-N,3-dimethylcyclopentan-1-amine is sourced from PubChem (CID 130920507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).