C10H23N — CID 91598782
ethane;N,N,3-trimethylcyclopentan-1-amine (PubChem CID 91598782) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is ethane;N,N,3-trimethylcyclopentan-1-amine.
| Compound Name | ethane;N,N,3-trimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 91598782 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | ethane;N,N,3-trimethylcyclopentan-1-amine |
| SMILES | CC.CC1CCC(N(C)C)C1 |
| InChI | InChI=1S/C8H17N.C2H6/c1-7-4-5-8(6-7)9(2)3;1-2/h7-8H,4-6H2,1-3H3;1-2H3 |
| InChIKey | SVLYQXRKDAPENJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |