C16H30N2 — CID 142894012
benzene;methanamine;N,N,4-trimethylcyclohexan-1-amine (PubChem CID 142894012) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is benzene;methanamine;N,N,4-trimethylcyclohexan-1-amine.
| Compound Name | benzene;methanamine;N,N,4-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 142894012 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | benzene;methanamine;N,N,4-trimethylcyclohexan-1-amine |
| SMILES | CC1CCC(N(C)C)CC1.CN.c1ccccc1 |
| InChI | InChI=1S/C9H19N.C6H6.CH5N/c1-8-4-6-9(7-5-8)10(2)3;1-2-4-6-5-3-1;1-2/h8-9H,4-7H2,1-3H3;1-6H;2H2,1H3 |
| InChIKey | WCHVFFUVNQUIJF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |