C8H22N2O2 — CID 175142686
4-N,4-N-dimethylcyclohexane-1,4-diamine;dihydrate (PubChem CID 175142686) has the molecular formula C8H22N2O2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-N,4-N-dimethylcyclohexane-1,4-diamine;dihydrate.
| Compound Name | 4-N,4-N-dimethylcyclohexane-1,4-diamine;dihydrate |
|---|---|
| PubChem CID | 175142686 |
| Molecular Formula | C8H22N2O2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 4-N,4-N-dimethylcyclohexane-1,4-diamine;dihydrate |
| SMILES | CN(C)C1CCC(N)CC1.O.O |
| InChI | InChI=1S/C8H18N2.2H2O/c1-10(2)8-5-3-7(9)4-6-8;;/h7-8H,3-6,9H2,1-2H3;2*1H2 |
| InChIKey | XLEHQFULYCRRLI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |