C10H24Cl2N2 — CID 53408661
4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride (PubChem CID 53408661) has the molecular formula C10H24Cl2N2 and a molecular weight of 243.22 g/mol. Its IUPAC name is 4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride.
| Compound Name | 4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 53408661 |
| Molecular Formula | C10H24Cl2N2 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride |
| SMILES | CCN(CC)C1CCC(N)CC1.Cl.Cl |
| InChI | InChI=1S/C10H22N2.2ClH/c1-3-12(4-2)10-7-5-9(11)6-8-10;;/h9-10H,3-8,11H2,1-2H3;2*1H |
| InChIKey | JSGOAXICWAZNHJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |