C15H35N — CID 145372894
N,N-diethyl-4-methylcyclohexan-1-amine;ethane (PubChem CID 145372894) has the molecular formula C15H35N and a molecular weight of 229.45 g/mol. Its IUPAC name is N,N-diethyl-4-methylcyclohexan-1-amine;ethane.
| Compound Name | N,N-diethyl-4-methylcyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 145372894 |
| Molecular Formula | C15H35N |
| Molecular Weight | 229.45 g/mol |
| Exact Mass | 229.28 |
| IUPAC Name | N,N-diethyl-4-methylcyclohexan-1-amine;ethane |
| SMILES | CC.CC.CCN(CC)C1CCC(C)CC1 |
| InChI | InChI=1S/C11H23N.2C2H6/c1-4-12(5-2)11-8-6-10(3)7-9-11;2*1-2/h10-11H,4-9H2,1-3H3;2*1-2H3 |
| InChIKey | NNYBKOODXHMZLZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |