About N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride
N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride (PubChem CID 23299105) has the molecular formula C12H26FN
and a molecular weight of 203.34 g/mol. Its IUPAC name is N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride.
Molecular Properties
| Compound Name | N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride |
| PubChem CID | 23299105 |
| Molecular Formula | C12H26FN |
| Molecular Weight | 203.34 g/mol |
| Exact Mass | 203.20 |
| IUPAC Name | N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride |
| SMILES | CCN(CC)C1CCCC(C)CC1.F |
| InChI | InChI=1S/C12H25N.FH/c1-4-13(5-2)12-8-6-7-11(3)9-10-12;/h11-12H,4-10H2,1-3H3;1H |
| InChIKey | LFEQMKPXFMXVIQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride?
The IUPAC name of N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride (CID 23299105) is N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride.
What is the SMILES notation for N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride?
The canonical SMILES for N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride is CCN(CC)C1CCCC(C)CC1.F.
What is the InChIKey of N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride?
The InChIKey is LFEQMKPXFMXVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N.FH/c1-4-13(5-2)12-8-6-7-11(3)9-10-12;/h11-12H,4-10H2,1-3H3;1H.
What are the key properties of N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride?
N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride has a molecular weight of 203.34 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-methylcycloheptan-1-amine;hydrofluoride is sourced from PubChem (CID 23299105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).