C12H29N — CID 170746144
N,N-diethylcyclobutanamine;ethane (PubChem CID 170746144) has the molecular formula C12H29N and a molecular weight of 187.37 g/mol. Its IUPAC name is N,N-diethylcyclobutanamine;ethane.
| Compound Name | N,N-diethylcyclobutanamine;ethane |
|---|---|
| PubChem CID | 170746144 |
| Molecular Formula | C12H29N |
| Molecular Weight | 187.37 g/mol |
| Exact Mass | 187.23 |
| IUPAC Name | N,N-diethylcyclobutanamine;ethane |
| SMILES | CC.CC.CCN(CC)C1CCC1 |
| InChI | InChI=1S/C8H17N.2C2H6/c1-3-9(4-2)8-6-5-7-8;2*1-2/h8H,3-7H2,1-2H3;2*1-2H3 |
| InChIKey | VGULXXZUAMWSPE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |