C12H22N2 — CID 79115467
4-N-but-2-ynyl-4-N-ethylcyclohexane-1,4-diamine (PubChem CID 79115467) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-N-but-2-ynyl-4-N-ethylcyclohexane-1,4-diamine.
| Compound Name | 4-N-but-2-ynyl-4-N-ethylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79115467 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4-N-but-2-ynyl-4-N-ethylcyclohexane-1,4-diamine |
| SMILES | CC#CCN(CC)C1CCC(N)CC1 |
| InChI | InChI=1S/C12H22N2/c1-3-5-10-14(4-2)12-8-6-11(13)7-9-12/h11-12H,4,6-10,13H2,1-2H3 |
| InChIKey | PMBSJUWFYMKCOI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|