C18H36N4 — CID 146391384
4-N,4-N-bis(4-aminocyclohexyl)cyclohexane-1,4-diamine (PubChem CID 146391384) has the molecular formula C18H36N4 and a molecular weight of 308.51 g/mol. Its IUPAC name is 4-N,4-N-bis(4-aminocyclohexyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N,4-N-bis(4-aminocyclohexyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 146391384 |
| Molecular Formula | C18H36N4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | 4-N,4-N-bis(4-aminocyclohexyl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(N(C2CCC(N)CC2)C2CCC(N)CC2)CC1 |
| InChI | InChI=1S/C18H36N4/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h13-18H,1-12,19-21H2 |
| InChIKey | XTHHQOQCIWEHPY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |