C13H26N4 — CID 154037827
N,N-bis(4-aminocyclohexyl)methanimidamide (PubChem CID 154037827) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is N,N-bis(4-aminocyclohexyl)methanimidamide.
| Compound Name | N,N-bis(4-aminocyclohexyl)methanimidamide |
|---|---|
| PubChem CID | 154037827 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | N,N-bis(4-aminocyclohexyl)methanimidamide |
| SMILES | [H]/N=C/N(C1CCC(N)CC1)C1CCC(N)CC1 |
| InChI | InChI=1S/C13H26N4/c14-9-17(12-5-1-10(15)2-6-12)13-7-3-11(16)4-8-13/h9-14H,1-8,15-16H2/b14-9+ |
| InChIKey | BRBCHJHDMNOPND-NTEUORMPSA-N |
| XLogP | 1.44 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|