C10H22N2 — CID 18419789
4-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine (PubChem CID 18419789) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 4-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 18419789 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 4-N-methyl-4-N-propan-2-ylcyclohexane-1,4-diamine |
| SMILES | CC(C)N(C)C1CCC(N)CC1 |
| InChI | InChI=1S/C10H22N2/c1-8(2)12(3)10-6-4-9(11)5-7-10/h8-10H,4-7,11H2,1-3H3 |
| InChIKey | PRPVULUNZGDXOO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |