C11H17NO — CID 130920569
(1R,6R)-6,9,9-trimethyl-2-azabicyclo[4.2.1]non-4-en-3-one (PubChem CID 130920569) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (1R,6R)-6,9,9-trimethyl-2-azabicyclo[4.2.1]non-4-en-3-one.
| Compound Name | (1R,6R)-6,9,9-trimethyl-2-azabicyclo[4.2.1]non-4-en-3-one |
|---|---|
| PubChem CID | 130920569 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1R,6R)-6,9,9-trimethyl-2-azabicyclo[4.2.1]non-4-en-3-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C=CC(=O)N2 |
| InChI | InChI=1S/C11H17NO/c1-10(2)8-4-6-11(10,3)7-5-9(13)12-8/h5,7-8H,4,6H2,1-3H3,(H,12,13)/t8-,11-/m1/s1 |
| InChIKey | IYARGDQGHRWRJY-LDYMZIIASA-N |
| XLogP | 1.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |