C19H29NO2 — CID 67651608
(3aS,3bR,9aR,9bR,11aS)-1-hydroxy-3,9a,11a-trimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one (PubChem CID 67651608) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bR,11aS)-1-hydroxy-3,9a,11a-trimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bR,9aR,9bR,11aS)-1-hydroxy-3,9a,11a-trimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 67651608 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (3aS,3bR,9aR,9bR,11aS)-1-hydroxy-3,9a,11a-trimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CC1CC(O)[C@@]2(C)CC[C@@H]3[C@@H](CCC4NC(=O)C=C[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C19H29NO2/c1-11-10-15(21)19(3)8-6-13-12(17(11)19)4-5-14-18(13,2)9-7-16(22)20-14/h7,9,11-15,17,21H,4-6,8,10H2,1-3H3,(H,20,22)/t11?,12-,13-,14?,15?,17+,18-,19-/m1/s1 |
| InChIKey | XKPKSWGRNKFNOW-YAITUUOOSA-N |
| XLogP | 2.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |