C26H40N2O2 — CID 57284606
(3aS,3bS,9aR,9bR,11aS)-1-(2,6-dimethylpiperidine-1-carbonyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one (PubChem CID 57284606) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-1-(2,6-dimethylpiperidine-1-carbonyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-1-(2,6-dimethylpiperidine-1-carbonyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 57284606 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-1-(2,6-dimethylpiperidine-1-carbonyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CC1CCCC(C)N1C(=O)C1CC[C@H]2[C@@H]3CCC4NC(=O)C=C[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40N2O2/c1-16-6-5-7-17(2)28(16)24(30)21-10-9-19-18-8-11-22-26(4,15-13-23(29)27-22)20(18)12-14-25(19,21)3/h13,15-22H,5-12,14H2,1-4H3,(H,27,29)/t16?,17?,18-,19-,20+,21?,22?,25-,26+/m0/s1 |
| InChIKey | FMFCTXMXCRCJPW-UQAPZPAQSA-N |
| XLogP | 4.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |