C9H15N3O2 — CID 130927622
4-ethyl-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol (PubChem CID 130927622) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-ethyl-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol.
| Compound Name | 4-ethyl-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130927622 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-ethyl-1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-3-ol |
| SMILES | CCC1CN(Cc2ncno2)CC1O |
| InChI | InChI=1S/C9H15N3O2/c1-2-7-3-12(4-8(7)13)5-9-10-6-11-14-9/h6-8,13H,2-5H2,1H3 |
| InChIKey | RBNCWWFXNYBMBY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |