C5H8Br2O2S — CID 13093090
(2R,3S)-2,3-dibromothiane 1,1-dioxide (PubChem CID 13093090) has the molecular formula C5H8Br2O2S and a molecular weight of 291.99 g/mol. Its IUPAC name is (2R,3S)-2,3-dibromothiane 1,1-dioxide.
| Compound Name | (2R,3S)-2,3-dibromothiane 1,1-dioxide |
|---|---|
| PubChem CID | 13093090 |
| Molecular Formula | C5H8Br2O2S |
| Molecular Weight | 291.99 g/mol |
| Exact Mass | 289.86 |
| IUPAC Name | (2R,3S)-2,3-dibromothiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC[C@H](Br)[C@H]1Br |
| InChI | InChI=1S/C5H8Br2O2S/c6-4-2-1-3-10(8,9)5(4)7/h4-5H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | QETLPVVQJSCFEJ-WHFBIAKZSA-N |
| XLogP | 1.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.99 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|