C11H19F2N — CID 130934240
3-[(2,2-difluorocyclopentyl)methyl]piperidine (PubChem CID 130934240) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-[(2,2-difluorocyclopentyl)methyl]piperidine.
| Compound Name | 3-[(2,2-difluorocyclopentyl)methyl]piperidine |
|---|---|
| PubChem CID | 130934240 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 3-[(2,2-difluorocyclopentyl)methyl]piperidine |
| SMILES | FC1(F)CCCC1CC1CCCNC1 |
| InChI | InChI=1S/C11H19F2N/c12-11(13)5-1-4-10(11)7-9-3-2-6-14-8-9/h9-10,14H,1-8H2 |
| InChIKey | KDJYQCKJBQLMBK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |